The condensed structural formula for 1,1-dimethylcyclobutane is C(CH3)2CH2CH2CH2, where the carbon atoms form a cyclic four-membered ring.
Understanding 1,1-Dimethylcyclobutane
1,1-Dimethylcyclobutane is an organic compound that belongs to the class of cycloalkanes. Its name provides key clues about its structure:
- "Cyclobutane": This indicates a four-carbon ring structure. In a condensed formula, each carbon in a saturated ring is typically a methylene group (CH2), unless substituted.
- "1,1-dimethyl": This specifies that two methyl groups (CH3) are attached to the same carbon atom within the cyclobutane ring. This designated carbon atom is conventionally labeled as position 1.
Deriving the Condensed Formula
To construct the condensed structural formula:
- Identify the base ring: A cyclobutane ring means four carbon atoms are linked in a ring.
- Locate the substituents: At position 1 of the ring, two methyl (CH3) groups are attached. This means that the carbon at position 1 will be represented as
C(CH3)2because it forms bonds with two methyl groups and two other carbons in the ring. - Fill in the rest of the ring: The remaining three carbons in the cyclobutane ring are methylene groups (CH2), as they are bonded to two other carbons within the ring and two hydrogen atoms to satisfy their valency.
Therefore, starting from the substituted carbon and tracing the ring, the condensed formula becomes C(CH3)2CH2CH2CH2, with the understanding that the last CH2 connects back to the initial C to complete the four-membered ring.
Key Characteristics of 1,1-Dimethylcyclobutane
Understanding its properties can further clarify its chemical identity. Below are some essential details about 1,1-dimethylcyclobutane:
| Property | Value |
|---|---|
| Chemical Formula | C6H12 |
| Molecular Weight | 84.15948 g/mol |
| IUPAC Name | 1,1-dimethylcyclobutane |
| SMILES String | CC1(C)CCC1 |
| InChI | InChI=1S/C6H12/c1-6(2)4-3-5-6/h3-5H2,1-2H3 |
These details confirm the composition and structure, matching the derived condensed formula. The molecular formula C6H12 indicates six carbon atoms and twelve hydrogen atoms, which aligns with the structural breakdown:
C(CH3)2contributes 3 carbon atoms (1 from the ring, 2 from methyl groups) and 6 hydrogen atoms (3 from each methyl group).- The three
CH2groups each contribute 1 carbon atom and 2 hydrogen atoms, totaling 3 carbon atoms and 6 hydrogen atoms. - Summing these, we get 3+3 = 6 carbon atoms and 6+6 = 12 hydrogen atoms, confirming C6H12.
For more information on the structure of 1,1-dimethylcyclobutane, you can explore chemical databases like Mol-Instincts.
